C27H16F3N4O2Zn- — CID 58836165
6-[2-[2-[6-[3-(trifluoromethyl)pyrazol-1-id-5-yl]-2-pyridinyl]phenyl]phenyl]pyridine-2-carboxylic acid;zinc (PubChem CID 58836165) has the molecular formula C27H16F3N4O2Zn- and a molecular weight of 550.84 g/mol. Its IUPAC name is 6-[2-[2-[6-[3-(trifluoromethyl)pyrazol-1-id-5-yl]-2-pyridinyl]phenyl]phenyl]pyridine-2-carboxylic acid;zinc.
| Compound Name | 6-[2-[2-[6-[3-(trifluoromethyl)pyrazol-1-id-5-yl]-2-pyridinyl]phenyl]phenyl]pyridine-2-carboxylic acid;zinc |
|---|---|
| PubChem CID | 58836165 |
| Molecular Formula | C27H16F3N4O2Zn- |
| Molecular Weight | 550.84 g/mol |
| Exact Mass | 549.05 |
| IUPAC Name | 6-[2-[2-[6-[3-(trifluoromethyl)pyrazol-1-id-5-yl]-2-pyridinyl]phenyl]phenyl]pyridine-2-carboxylic acid;zinc |
| SMILES | O=C(O)c1cccc(-c2ccccc2-c2ccccc2-c2cccc(-c3cc(C(F)(F)F)n[n-]3)n2)n1.[Zn] |
| InChI | InChI=1S/C27H17F3N4O2.Zn/c28-27(29,30)25-15-24(33-34-25)22-13-5-11-20(31-22)18-9-3-1-7-16(18)17-8-2-4-10-19(17)21-12-6-14-23(32-21)26(35)36;/h1-15H,(H2,31,33,34,35,36);/p-1 |
| InChIKey | CLKDYNWBNSFHFI-UHFFFAOYSA-M |
| XLogP | 6.21 |
| TPSA | 90.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.84 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|