C38H69N9S3 — CID 58836257
3-[3,5-bis(4-nonyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)pentyl]-4-nonyl-1H-1,2,4-triazole-5-thione (PubChem CID 58836257) has the molecular formula C38H69N9S3 and a molecular weight of 748.23 g/mol. Its IUPAC name is 3-[3,5-bis(4-nonyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)pentyl]-4-nonyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[3,5-bis(4-nonyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)pentyl]-4-nonyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 58836257 |
| Molecular Formula | C38H69N9S3 |
| Molecular Weight | 748.23 g/mol |
| Exact Mass | 747.48 |
| IUPAC Name | 3-[3,5-bis(4-nonyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)pentyl]-4-nonyl-1H-1,2,4-triazole-5-thione |
| SMILES | CCCCCCCCCn1c(CCC(CCc2n[nH]c(=S)n2CCCCCCCCC)c2n[nH]c(=S)n2CCCCCCCCC)n[nH]c1=S |
| InChI | InChI=1S/C38H69N9S3/c1-4-7-10-13-16-19-22-29-45-33(39-42-36(45)48)27-25-32(35-41-44-38(50)47(35)31-24-21-18-15-12-9-6-3)26-28-34-40-43-37(49)46(34)30-23-20-17-14-11-8-5-2/h32H,4-31H2,1-3H3,(H,42,48)(H,43,49)(H,44,50) |
| InChIKey | HOHQGWCNXRZSPY-UHFFFAOYSA-N |
| XLogP | 12.05 |
| TPSA | 100.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.23 |
| LogP ≤ 5 | 12.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|