C9H9N3OS — CID 58841102
3-amino-5-methyl-1,2-benzothiazole-6-carboxamide (PubChem CID 58841102) has the molecular formula C9H9N3OS and a molecular weight of 207.26 g/mol. Its IUPAC name is 3-amino-5-methyl-1,2-benzothiazole-6-carboxamide.
| Compound Name | 3-amino-5-methyl-1,2-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 58841102 |
| Molecular Formula | C9H9N3OS |
| Molecular Weight | 207.26 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | 3-amino-5-methyl-1,2-benzothiazole-6-carboxamide |
| SMILES | Cc1cc2c(N)nsc2cc1C(N)=O |
| InChI | InChI=1S/C9H9N3OS/c1-4-2-6-7(14-12-8(6)10)3-5(4)9(11)13/h2-3H,1H3,(H2,10,12)(H2,11,13) |
| InChIKey | ZOHZFNKBXQZLDH-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.26 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |