C35H42F3N3O4S — CID 58841390
N-[6-[(tert-butylamino)methyl]-1,2,3,4-tetrahydronaphthalen-1-yl]-2-[(2S,4R)-4-phenylmethoxy-1-[3-(trifluoromethyl)phenyl]sulfonylpyrrolidin-2-yl]acetamide (PubChem CID 58841390) has the molecular formula C35H42F3N3O4S and a molecular weight of 657.80 g/mol. Its IUPAC name is N-[6-[(tert-butylamino)methyl]-1,2,3,4-tetrahydronaphthalen-1-yl]-2-[(2S,4R)-4-phenylmethoxy-1-[3-(trifluoromethyl)phenyl]sulfonylpyrrolidin-2-yl]acetamide.
| Compound Name | N-[6-[(tert-butylamino)methyl]-1,2,3,4-tetrahydronaphthalen-1-yl]-2-[(2S,4R)-4-phenylmethoxy-1-[3-(trifluoromethyl)phenyl]sulfonylpyrrolidin-2-yl]acetamide |
|---|---|
| PubChem CID | 58841390 |
| Molecular Formula | C35H42F3N3O4S |
| Molecular Weight | 657.80 g/mol |
| Exact Mass | 657.28 |
| IUPAC Name | N-[6-[(tert-butylamino)methyl]-1,2,3,4-tetrahydronaphthalen-1-yl]-2-[(2S,4R)-4-phenylmethoxy-1-[3-(trifluoromethyl)phenyl]sulfonylpyrrolidin-2-yl]acetamide |
| SMILES | CC(C)(C)NCc1ccc2c(c1)CCCC2NC(=O)C[C@@H]1C[C@@H](OCc2ccccc2)CN1S(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C35H42F3N3O4S/c1-34(2,3)39-21-25-15-16-31-26(17-25)11-7-14-32(31)40-33(42)20-28-19-29(45-23-24-9-5-4-6-10-24)22-41(28)46(43,44)30-13-8-12-27(18-30)35(36,37)38/h4-6,8-10,12-13,15-18,28-29,32,39H,7,11,14,19-23H2,1-3H3,(H,40,42)/t28-,29+,32?/m0/s1 |
| InChIKey | AYUPITAYCMELDN-QSVHXPHUSA-N |
| XLogP | 6.53 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.80 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |