C31H34Br2F3N3O3S — CID 59792182
(3R)-N-[(1R)-6-[(tert-butylamino)methyl]-1,2,3,4-tetrahydronaphthalen-1-yl]-3-(3,5-dibromophenyl)-3-[[3-(trifluoromethyl)phenyl]sulfonylamino]propanamide (PubChem CID 59792182) has the molecular formula C31H34Br2F3N3O3S and a molecular weight of 745.50 g/mol. Its IUPAC name is (3R)-N-[(1R)-6-[(tert-butylamino)methyl]-1,2,3,4-tetrahydronaphthalen-1-yl]-3-(3,5-dibromophenyl)-3-[[3-(trifluoromethyl)phenyl]sulfonylamino]propanamide.
| Compound Name | (3R)-N-[(1R)-6-[(tert-butylamino)methyl]-1,2,3,4-tetrahydronaphthalen-1-yl]-3-(3,5-dibromophenyl)-3-[[3-(trifluoromethyl)phenyl]sulfonylamino]propanamide |
|---|---|
| PubChem CID | 59792182 |
| Molecular Formula | C31H34Br2F3N3O3S |
| Molecular Weight | 745.50 g/mol |
| Exact Mass | 743.06 |
| IUPAC Name | (3R)-N-[(1R)-6-[(tert-butylamino)methyl]-1,2,3,4-tetrahydronaphthalen-1-yl]-3-(3,5-dibromophenyl)-3-[[3-(trifluoromethyl)phenyl]sulfonylamino]propanamide |
| SMILES | CC(C)(C)NCc1ccc2c(c1)CCC[C@H]2NC(=O)C[C@@H](NS(=O)(=O)c1cccc(C(F)(F)F)c1)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C31H34Br2F3N3O3S/c1-30(2,3)37-18-19-10-11-26-20(12-19)6-4-9-27(26)38-29(40)17-28(21-13-23(32)16-24(33)14-21)39-43(41,42)25-8-5-7-22(15-25)31(34,35)36/h5,7-8,10-16,27-28,37,39H,4,6,9,17-18H2,1-3H3,(H,38,40)/t27-,28-/m1/s1 |
| InChIKey | YSRGDDODMWBWNV-VSGBNLITSA-N |
| XLogP | 7.72 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.50 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |