C31H32F3N3O3S — CID 68932209
N-[6-(2,5-dihydropyrrol-1-ylmethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-3-phenyl-3-[[3-(trifluoromethyl)phenyl]sulfonylamino]propanamide (PubChem CID 68932209) has the molecular formula C31H32F3N3O3S and a molecular weight of 583.68 g/mol. Its IUPAC name is N-[6-(2,5-dihydropyrrol-1-ylmethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-3-phenyl-3-[[3-(trifluoromethyl)phenyl]sulfonylamino]propanamide.
| Compound Name | N-[6-(2,5-dihydropyrrol-1-ylmethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-3-phenyl-3-[[3-(trifluoromethyl)phenyl]sulfonylamino]propanamide |
|---|---|
| PubChem CID | 68932209 |
| Molecular Formula | C31H32F3N3O3S |
| Molecular Weight | 583.68 g/mol |
| Exact Mass | 583.21 |
| IUPAC Name | N-[6-(2,5-dihydropyrrol-1-ylmethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-3-phenyl-3-[[3-(trifluoromethyl)phenyl]sulfonylamino]propanamide |
| SMILES | O=C(CC(NS(=O)(=O)c1cccc(C(F)(F)F)c1)c1ccccc1)NC1CCCc2cc(CN3CC=CC3)ccc21 |
| InChI | InChI=1S/C31H32F3N3O3S/c32-31(33,34)25-11-7-12-26(19-25)41(39,40)36-29(23-8-2-1-3-9-23)20-30(38)35-28-13-6-10-24-18-22(14-15-27(24)28)21-37-16-4-5-17-37/h1-5,7-9,11-12,14-15,18-19,28-29,36H,6,10,13,16-17,20-21H2,(H,35,38) |
| InChIKey | HKJLLCSRVJJOFF-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.68 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|