C27H31F6N3O3S — CID 11635676
(3R)-4,4,4-trifluoro-N-[6-(piperidin-1-ylmethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-3-[[3-(trifluoromethyl)phenyl]sulfonylamino]butanamide (PubChem CID 11635676) has the molecular formula C27H31F6N3O3S and a molecular weight of 591.62 g/mol. Its IUPAC name is (3R)-4,4,4-trifluoro-N-[6-(piperidin-1-ylmethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-3-[[3-(trifluoromethyl)phenyl]sulfonylamino]butanamide.
| Compound Name | (3R)-4,4,4-trifluoro-N-[6-(piperidin-1-ylmethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-3-[[3-(trifluoromethyl)phenyl]sulfonylamino]butanamide |
|---|---|
| PubChem CID | 11635676 |
| Molecular Formula | C27H31F6N3O3S |
| Molecular Weight | 591.62 g/mol |
| Exact Mass | 591.20 |
| IUPAC Name | (3R)-4,4,4-trifluoro-N-[6-(piperidin-1-ylmethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-3-[[3-(trifluoromethyl)phenyl]sulfonylamino]butanamide |
| SMILES | O=C(C[C@@H](NS(=O)(=O)c1cccc(C(F)(F)F)c1)C(F)(F)F)NC1CCCc2cc(CN3CCCCC3)ccc21 |
| InChI | InChI=1S/C27H31F6N3O3S/c28-26(29,30)20-7-5-8-21(15-20)40(38,39)35-24(27(31,32)33)16-25(37)34-23-9-4-6-19-14-18(10-11-22(19)23)17-36-12-2-1-3-13-36/h5,7-8,10-11,14-15,23-24,35H,1-4,6,9,12-13,16-17H2,(H,34,37)/t23?,24-/m1/s1 |
| InChIKey | DBLFXWULCZOUBM-XMMISQBUSA-N |
| XLogP | 5.48 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.62 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |