C26H30Cl2F3N3O4S — CID 154164442
(3S)-3-[(3,5-dichloro-2-hydroxyphenyl)sulfonylamino]-4,4,4-trifluoro-N-[(1R)-6-(piperidin-1-ylmethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]butanamide (PubChem CID 154164442) has the molecular formula C26H30Cl2F3N3O4S and a molecular weight of 608.51 g/mol. Its IUPAC name is (3S)-3-[(3,5-dichloro-2-hydroxyphenyl)sulfonylamino]-4,4,4-trifluoro-N-[(1R)-6-(piperidin-1-ylmethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]butanamide.
| Compound Name | (3S)-3-[(3,5-dichloro-2-hydroxyphenyl)sulfonylamino]-4,4,4-trifluoro-N-[(1R)-6-(piperidin-1-ylmethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]butanamide |
|---|---|
| PubChem CID | 154164442 |
| Molecular Formula | C26H30Cl2F3N3O4S |
| Molecular Weight | 608.51 g/mol |
| Exact Mass | 607.13 |
| IUPAC Name | (3S)-3-[(3,5-dichloro-2-hydroxyphenyl)sulfonylamino]-4,4,4-trifluoro-N-[(1R)-6-(piperidin-1-ylmethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]butanamide |
| SMILES | O=C(C[C@H](NS(=O)(=O)c1cc(Cl)cc(Cl)c1O)C(F)(F)F)N[C@@H]1CCCc2cc(CN3CCCCC3)ccc21 |
| InChI | InChI=1S/C26H30Cl2F3N3O4S/c27-18-12-20(28)25(36)22(13-18)39(37,38)33-23(26(29,30)31)14-24(35)32-21-6-4-5-17-11-16(7-8-19(17)21)15-34-9-2-1-3-10-34/h7-8,11-13,21,23,33,36H,1-6,9-10,14-15H2,(H,32,35)/t21-,23+/m1/s1 |
| InChIKey | HDTPVCNWYZODGH-GGAORHGYSA-N |
| XLogP | 5.48 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.51 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfonamide_A(43)', 'substructure': 'N/A'} |
|---|