C27H35ClF3N3O3S — CID 11577796
(3R)-N-[(1R)-6-[(tert-butylamino)methyl]-1,2,3,4-tetrahydronaphthalen-1-yl]-3-[(4-chloro-2,5-dimethylphenyl)sulfonylamino]-4,4,4-trifluorobutanamide (PubChem CID 11577796) has the molecular formula C27H35ClF3N3O3S and a molecular weight of 574.11 g/mol. Its IUPAC name is (3R)-N-[(1R)-6-[(tert-butylamino)methyl]-1,2,3,4-tetrahydronaphthalen-1-yl]-3-[(4-chloro-2,5-dimethylphenyl)sulfonylamino]-4,4,4-trifluorobutanamide.
| Compound Name | (3R)-N-[(1R)-6-[(tert-butylamino)methyl]-1,2,3,4-tetrahydronaphthalen-1-yl]-3-[(4-chloro-2,5-dimethylphenyl)sulfonylamino]-4,4,4-trifluorobutanamide |
|---|---|
| PubChem CID | 11577796 |
| Molecular Formula | C27H35ClF3N3O3S |
| Molecular Weight | 574.11 g/mol |
| Exact Mass | 573.20 |
| IUPAC Name | (3R)-N-[(1R)-6-[(tert-butylamino)methyl]-1,2,3,4-tetrahydronaphthalen-1-yl]-3-[(4-chloro-2,5-dimethylphenyl)sulfonylamino]-4,4,4-trifluorobutanamide |
| SMILES | Cc1cc(S(=O)(=O)N[C@H](CC(=O)N[C@@H]2CCCc3cc(CNC(C)(C)C)ccc32)C(F)(F)F)c(C)cc1Cl |
| InChI | InChI=1S/C27H35ClF3N3O3S/c1-16-12-23(17(2)11-21(16)28)38(36,37)34-24(27(29,30)31)14-25(35)33-22-8-6-7-19-13-18(9-10-20(19)22)15-32-26(3,4)5/h9-13,22,24,32,34H,6-8,14-15H2,1-5H3,(H,33,35)/t22-,24-/m1/s1 |
| InChIKey | ZXTDAJVAACIGTG-ISKFKSNPSA-N |
| XLogP | 5.64 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.11 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |