C32H38N4O3S2 — CID 59792298
(3R)-N-[(1R)-6-[(tert-butylamino)methyl]-1,2,3,4-tetrahydronaphthalen-1-yl]-3-[(2-methyl-1,3-benzothiazol-5-yl)sulfonylamino]-3-phenylpropanamide (PubChem CID 59792298) has the molecular formula C32H38N4O3S2 and a molecular weight of 590.82 g/mol. Its IUPAC name is (3R)-N-[(1R)-6-[(tert-butylamino)methyl]-1,2,3,4-tetrahydronaphthalen-1-yl]-3-[(2-methyl-1,3-benzothiazol-5-yl)sulfonylamino]-3-phenylpropanamide.
| Compound Name | (3R)-N-[(1R)-6-[(tert-butylamino)methyl]-1,2,3,4-tetrahydronaphthalen-1-yl]-3-[(2-methyl-1,3-benzothiazol-5-yl)sulfonylamino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 59792298 |
| Molecular Formula | C32H38N4O3S2 |
| Molecular Weight | 590.82 g/mol |
| Exact Mass | 590.24 |
| IUPAC Name | (3R)-N-[(1R)-6-[(tert-butylamino)methyl]-1,2,3,4-tetrahydronaphthalen-1-yl]-3-[(2-methyl-1,3-benzothiazol-5-yl)sulfonylamino]-3-phenylpropanamide |
| SMILES | Cc1nc2cc(S(=O)(=O)N[C@H](CC(=O)N[C@@H]3CCCc4cc(CNC(C)(C)C)ccc43)c3ccccc3)ccc2s1 |
| InChI | InChI=1S/C32H38N4O3S2/c1-21-34-29-18-25(14-16-30(29)40-21)41(38,39)36-28(23-9-6-5-7-10-23)19-31(37)35-27-12-8-11-24-17-22(13-15-26(24)27)20-33-32(2,3)4/h5-7,9-10,13-18,27-28,33,36H,8,11-12,19-20H2,1-4H3,(H,35,37)/t27-,28-/m1/s1 |
| InChIKey | NMSVDURWBNMJHU-VSGBNLITSA-N |
| XLogP | 6.10 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.82 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |