C34H40F3N3O3S — CID 59792147
(3R)-N-[(1R)-6-[3-(2,2-dimethylpropylamino)prop-1-en-2-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]-3-phenyl-3-[[3-(trifluoromethyl)phenyl]sulfonylamino]propanamide (PubChem CID 59792147) has the molecular formula C34H40F3N3O3S and a molecular weight of 627.77 g/mol. Its IUPAC name is (3R)-N-[(1R)-6-[3-(2,2-dimethylpropylamino)prop-1-en-2-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]-3-phenyl-3-[[3-(trifluoromethyl)phenyl]sulfonylamino]propanamide.
| Compound Name | (3R)-N-[(1R)-6-[3-(2,2-dimethylpropylamino)prop-1-en-2-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]-3-phenyl-3-[[3-(trifluoromethyl)phenyl]sulfonylamino]propanamide |
|---|---|
| PubChem CID | 59792147 |
| Molecular Formula | C34H40F3N3O3S |
| Molecular Weight | 627.77 g/mol |
| Exact Mass | 627.27 |
| IUPAC Name | (3R)-N-[(1R)-6-[3-(2,2-dimethylpropylamino)prop-1-en-2-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]-3-phenyl-3-[[3-(trifluoromethyl)phenyl]sulfonylamino]propanamide |
| SMILES | C=C(CNCC(C)(C)C)c1ccc2c(c1)CCC[C@H]2NC(=O)C[C@@H](NS(=O)(=O)c1cccc(C(F)(F)F)c1)c1ccccc1 |
| InChI | InChI=1S/C34H40F3N3O3S/c1-23(21-38-22-33(2,3)4)25-16-17-29-26(18-25)12-8-15-30(29)39-32(41)20-31(24-10-6-5-7-11-24)40-44(42,43)28-14-9-13-27(19-28)34(35,36)37/h5-7,9-11,13-14,16-19,30-31,38,40H,1,8,12,15,20-22H2,2-4H3,(H,39,41)/t30-,31-/m1/s1 |
| InChIKey | RFHCQWAXNWSWGO-FIRIVFDPSA-N |
| XLogP | 6.96 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.77 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |