C35H38F3N3O5S — CID 59792324
methyl (2S)-1-[2-[(5R)-5-[[(3R)-3-phenyl-3-[[3-(trifluoromethyl)phenyl]sulfonylamino]propanoyl]amino]-5,6,7,8-tetrahydronaphthalen-2-yl]prop-2-enyl]pyrrolidine-2-carboxylate (PubChem CID 59792324) has the molecular formula C35H38F3N3O5S and a molecular weight of 669.77 g/mol. Its IUPAC name is methyl (2S)-1-[2-[(5R)-5-[[(3R)-3-phenyl-3-[[3-(trifluoromethyl)phenyl]sulfonylamino]propanoyl]amino]-5,6,7,8-tetrahydronaphthalen-2-yl]prop-2-enyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S)-1-[2-[(5R)-5-[[(3R)-3-phenyl-3-[[3-(trifluoromethyl)phenyl]sulfonylamino]propanoyl]amino]-5,6,7,8-tetrahydronaphthalen-2-yl]prop-2-enyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 59792324 |
| Molecular Formula | C35H38F3N3O5S |
| Molecular Weight | 669.77 g/mol |
| Exact Mass | 669.25 |
| IUPAC Name | methyl (2S)-1-[2-[(5R)-5-[[(3R)-3-phenyl-3-[[3-(trifluoromethyl)phenyl]sulfonylamino]propanoyl]amino]-5,6,7,8-tetrahydronaphthalen-2-yl]prop-2-enyl]pyrrolidine-2-carboxylate |
| SMILES | C=C(CN1CCC[C@H]1C(=O)OC)c1ccc2c(c1)CCC[C@H]2NC(=O)C[C@@H](NS(=O)(=O)c1cccc(C(F)(F)F)c1)c1ccccc1 |
| InChI | InChI=1S/C35H38F3N3O5S/c1-23(22-41-18-8-15-32(41)34(43)46-2)25-16-17-29-26(19-25)11-6-14-30(29)39-33(42)21-31(24-9-4-3-5-10-24)40-47(44,45)28-13-7-12-27(20-28)35(36,37)38/h3-5,7,9-10,12-13,16-17,19-20,30-32,40H,1,6,8,11,14-15,18,21-22H2,2H3,(H,39,42)/t30-,31-,32+/m1/s1 |
| InChIKey | YAMSQLWLGIIFRY-IWWXRALLSA-N |
| XLogP | 5.96 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.77 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |