C27H38ClN3O3S — CID 154112594
(3S)-N-[(1R)-6-[(tert-butylamino)methyl]-1,2,3,4-tetrahydronaphthalen-1-yl]-3-[(4-chloro-2,5-dimethylphenyl)sulfonylamino]butanamide (PubChem CID 154112594) has the molecular formula C27H38ClN3O3S and a molecular weight of 520.14 g/mol. Its IUPAC name is (3S)-N-[(1R)-6-[(tert-butylamino)methyl]-1,2,3,4-tetrahydronaphthalen-1-yl]-3-[(4-chloro-2,5-dimethylphenyl)sulfonylamino]butanamide.
| Compound Name | (3S)-N-[(1R)-6-[(tert-butylamino)methyl]-1,2,3,4-tetrahydronaphthalen-1-yl]-3-[(4-chloro-2,5-dimethylphenyl)sulfonylamino]butanamide |
|---|---|
| PubChem CID | 154112594 |
| Molecular Formula | C27H38ClN3O3S |
| Molecular Weight | 520.14 g/mol |
| Exact Mass | 519.23 |
| IUPAC Name | (3S)-N-[(1R)-6-[(tert-butylamino)methyl]-1,2,3,4-tetrahydronaphthalen-1-yl]-3-[(4-chloro-2,5-dimethylphenyl)sulfonylamino]butanamide |
| SMILES | Cc1cc(S(=O)(=O)N[C@@H](C)CC(=O)N[C@@H]2CCCc3cc(CNC(C)(C)C)ccc32)c(C)cc1Cl |
| InChI | InChI=1S/C27H38ClN3O3S/c1-17-13-25(18(2)12-23(17)28)35(33,34)31-19(3)14-26(32)30-24-9-7-8-21-15-20(10-11-22(21)24)16-29-27(4,5)6/h10-13,15,19,24,29,31H,7-9,14,16H2,1-6H3,(H,30,32)/t19-,24+/m0/s1 |
| InChIKey | CNJGUHJBSIYSDL-YADARESESA-N |
| XLogP | 5.10 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.14 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |