C30H37ClN4O4S — CID 68679788
2-[(3R)-4-(4-chloro-2,5-dimethylphenyl)sulfonyl-2-oxo-1,3-dihydropyrazin-3-yl]-N-[(1R)-6-[(cyclopentylamino)methyl]-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide (PubChem CID 68679788) has the molecular formula C30H37ClN4O4S and a molecular weight of 585.17 g/mol. Its IUPAC name is 2-[(3R)-4-(4-chloro-2,5-dimethylphenyl)sulfonyl-2-oxo-1,3-dihydropyrazin-3-yl]-N-[(1R)-6-[(cyclopentylamino)methyl]-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide.
| Compound Name | 2-[(3R)-4-(4-chloro-2,5-dimethylphenyl)sulfonyl-2-oxo-1,3-dihydropyrazin-3-yl]-N-[(1R)-6-[(cyclopentylamino)methyl]-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide |
|---|---|
| PubChem CID | 68679788 |
| Molecular Formula | C30H37ClN4O4S |
| Molecular Weight | 585.17 g/mol |
| Exact Mass | 584.22 |
| IUPAC Name | 2-[(3R)-4-(4-chloro-2,5-dimethylphenyl)sulfonyl-2-oxo-1,3-dihydropyrazin-3-yl]-N-[(1R)-6-[(cyclopentylamino)methyl]-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide |
| SMILES | Cc1cc(S(=O)(=O)N2C=CNC(=O)[C@H]2CC(=O)N[C@@H]2CCCc3cc(CNC4CCCC4)ccc32)c(C)cc1Cl |
| InChI | InChI=1S/C30H37ClN4O4S/c1-19-15-28(20(2)14-25(19)31)40(38,39)35-13-12-32-30(37)27(35)17-29(36)34-26-9-5-6-22-16-21(10-11-24(22)26)18-33-23-7-3-4-8-23/h10-16,23,26-27,33H,3-9,17-18H2,1-2H3,(H,32,37)(H,34,36)/t26-,27-/m1/s1 |
| InChIKey | CUTQJSURSTVNEW-KAYWLYCHSA-N |
| XLogP | 4.53 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.17 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |