C29H34Cl2N4O4S — CID 11714179
2-[(3R)-4-(3,4-dichlorophenyl)sulfonyl-2-oxo-1,3-dihydropyrazin-3-yl]-N-[(1R)-6-(2-piperidin-1-ylethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide (PubChem CID 11714179) has the molecular formula C29H34Cl2N4O4S and a molecular weight of 605.59 g/mol. Its IUPAC name is 2-[(3R)-4-(3,4-dichlorophenyl)sulfonyl-2-oxo-1,3-dihydropyrazin-3-yl]-N-[(1R)-6-(2-piperidin-1-ylethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide.
| Compound Name | 2-[(3R)-4-(3,4-dichlorophenyl)sulfonyl-2-oxo-1,3-dihydropyrazin-3-yl]-N-[(1R)-6-(2-piperidin-1-ylethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide |
|---|---|
| PubChem CID | 11714179 |
| Molecular Formula | C29H34Cl2N4O4S |
| Molecular Weight | 605.59 g/mol |
| Exact Mass | 604.17 |
| IUPAC Name | 2-[(3R)-4-(3,4-dichlorophenyl)sulfonyl-2-oxo-1,3-dihydropyrazin-3-yl]-N-[(1R)-6-(2-piperidin-1-ylethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide |
| SMILES | O=C(C[C@@H]1C(=O)NC=CN1S(=O)(=O)c1ccc(Cl)c(Cl)c1)N[C@@H]1CCCc2cc(CCN3CCCCC3)ccc21 |
| InChI | InChI=1S/C29H34Cl2N4O4S/c30-24-10-8-22(18-25(24)31)40(38,39)35-16-12-32-29(37)27(35)19-28(36)33-26-6-4-5-21-17-20(7-9-23(21)26)11-15-34-13-2-1-3-14-34/h7-10,12,16-18,26-27H,1-6,11,13-15,19H2,(H,32,37)(H,33,36)/t26-,27-/m1/s1 |
| InChIKey | VULOJXSQUXXVBA-KAYWLYCHSA-N |
| XLogP | 4.57 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.59 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |