C27H38N6O4S — CID 68680254
N-[(4S)-1-[2-(2,2-dimethylpropylamino)ethyl]-4,5,6,7-tetrahydroindazol-4-yl]-2-[(3R)-4-(4-methylphenyl)sulfonyl-2-oxo-1,3-dihydropyrazin-3-yl]acetamide (PubChem CID 68680254) has the molecular formula C27H38N6O4S and a molecular weight of 542.71 g/mol. Its IUPAC name is N-[(4S)-1-[2-(2,2-dimethylpropylamino)ethyl]-4,5,6,7-tetrahydroindazol-4-yl]-2-[(3R)-4-(4-methylphenyl)sulfonyl-2-oxo-1,3-dihydropyrazin-3-yl]acetamide.
| Compound Name | N-[(4S)-1-[2-(2,2-dimethylpropylamino)ethyl]-4,5,6,7-tetrahydroindazol-4-yl]-2-[(3R)-4-(4-methylphenyl)sulfonyl-2-oxo-1,3-dihydropyrazin-3-yl]acetamide |
|---|---|
| PubChem CID | 68680254 |
| Molecular Formula | C27H38N6O4S |
| Molecular Weight | 542.71 g/mol |
| Exact Mass | 542.27 |
| IUPAC Name | N-[(4S)-1-[2-(2,2-dimethylpropylamino)ethyl]-4,5,6,7-tetrahydroindazol-4-yl]-2-[(3R)-4-(4-methylphenyl)sulfonyl-2-oxo-1,3-dihydropyrazin-3-yl]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N2C=CNC(=O)[C@H]2CC(=O)N[C@H]2CCCc3c2cnn3CCNCC(C)(C)C)cc1 |
| InChI | InChI=1S/C27H38N6O4S/c1-19-8-10-20(11-9-19)38(36,37)33-15-13-29-26(35)24(33)16-25(34)31-22-6-5-7-23-21(22)17-30-32(23)14-12-28-18-27(2,3)4/h8-11,13,15,17,22,24,28H,5-7,12,14,16,18H2,1-4H3,(H,29,35)(H,31,34)/t22-,24+/m0/s1 |
| InChIKey | YLIXKCDSTNGKQB-LADGPHEKSA-N |
| XLogP | 2.37 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.71 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|