C24H29N5O7S2 — CID 87538711
2-[(5R)-5-[[2-[(3S)-4-(4-methylphenyl)sulfonyl-2-oxo-1,3-dihydropyrazin-3-yl]acetyl]amino]-5,6,7,8-tetrahydroquinazolin-2-yl]ethyl methanesulfonate (PubChem CID 87538711) has the molecular formula C24H29N5O7S2 and a molecular weight of 563.66 g/mol. Its IUPAC name is 2-[(5R)-5-[[2-[(3S)-4-(4-methylphenyl)sulfonyl-2-oxo-1,3-dihydropyrazin-3-yl]acetyl]amino]-5,6,7,8-tetrahydroquinazolin-2-yl]ethyl methanesulfonate.
| Compound Name | 2-[(5R)-5-[[2-[(3S)-4-(4-methylphenyl)sulfonyl-2-oxo-1,3-dihydropyrazin-3-yl]acetyl]amino]-5,6,7,8-tetrahydroquinazolin-2-yl]ethyl methanesulfonate |
|---|---|
| PubChem CID | 87538711 |
| Molecular Formula | C24H29N5O7S2 |
| Molecular Weight | 563.66 g/mol |
| Exact Mass | 563.15 |
| IUPAC Name | 2-[(5R)-5-[[2-[(3S)-4-(4-methylphenyl)sulfonyl-2-oxo-1,3-dihydropyrazin-3-yl]acetyl]amino]-5,6,7,8-tetrahydroquinazolin-2-yl]ethyl methanesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)N2C=CNC(=O)[C@@H]2CC(=O)N[C@@H]2CCCc3nc(CCOS(C)(=O)=O)ncc32)cc1 |
| InChI | InChI=1S/C24H29N5O7S2/c1-16-6-8-17(9-7-16)38(34,35)29-12-11-25-24(31)21(29)14-23(30)28-20-5-3-4-19-18(20)15-26-22(27-19)10-13-36-37(2,32)33/h6-9,11-12,15,20-21H,3-5,10,13-14H2,1-2H3,(H,25,31)(H,28,30)/t20-,21+/m1/s1 |
| InChIKey | ZOLYURMIYSFTIF-RTWAWAEBSA-N |
| XLogP | 0.85 |
| TPSA | 164.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.66 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|