C28H34N4O4S — CID 68680007
N-[6-[(1R)-1-(cyclopropylamino)ethyl]-1,2,3,4-tetrahydronaphthalen-1-yl]-2-[(3R)-4-(4-methylphenyl)sulfonyl-2-oxo-1,3-dihydropyrazin-3-yl]acetamide (PubChem CID 68680007) has the molecular formula C28H34N4O4S and a molecular weight of 522.67 g/mol. Its IUPAC name is N-[6-[(1R)-1-(cyclopropylamino)ethyl]-1,2,3,4-tetrahydronaphthalen-1-yl]-2-[(3R)-4-(4-methylphenyl)sulfonyl-2-oxo-1,3-dihydropyrazin-3-yl]acetamide.
| Compound Name | N-[6-[(1R)-1-(cyclopropylamino)ethyl]-1,2,3,4-tetrahydronaphthalen-1-yl]-2-[(3R)-4-(4-methylphenyl)sulfonyl-2-oxo-1,3-dihydropyrazin-3-yl]acetamide |
|---|---|
| PubChem CID | 68680007 |
| Molecular Formula | C28H34N4O4S |
| Molecular Weight | 522.67 g/mol |
| Exact Mass | 522.23 |
| IUPAC Name | N-[6-[(1R)-1-(cyclopropylamino)ethyl]-1,2,3,4-tetrahydronaphthalen-1-yl]-2-[(3R)-4-(4-methylphenyl)sulfonyl-2-oxo-1,3-dihydropyrazin-3-yl]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N2C=CNC(=O)[C@H]2CC(=O)NC2CCCc3cc([C@@H](C)NC4CC4)ccc32)cc1 |
| InChI | InChI=1S/C28H34N4O4S/c1-18-6-11-23(12-7-18)37(35,36)32-15-14-29-28(34)26(32)17-27(33)31-25-5-3-4-21-16-20(8-13-24(21)25)19(2)30-22-9-10-22/h6-8,11-16,19,22,25-26,30H,3-5,9-10,17H2,1-2H3,(H,29,34)(H,31,33)/t19-,25?,26-/m1/s1 |
| InChIKey | IPGOQUUKHCDIFL-QULIKTJYSA-N |
| XLogP | 3.35 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.67 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |