C26H40N4O4S — CID 68941901
N-[(1R,4R)-4-(2,2-dimethylpropylamino)-2,2-dimethylcyclohexyl]-2-[(3R)-4-(4-methylphenyl)sulfonyl-2-oxo-1,3-dihydropyrazin-3-yl]acetamide (PubChem CID 68941901) has the molecular formula C26H40N4O4S and a molecular weight of 504.70 g/mol. Its IUPAC name is N-[(1R,4R)-4-(2,2-dimethylpropylamino)-2,2-dimethylcyclohexyl]-2-[(3R)-4-(4-methylphenyl)sulfonyl-2-oxo-1,3-dihydropyrazin-3-yl]acetamide.
| Compound Name | N-[(1R,4R)-4-(2,2-dimethylpropylamino)-2,2-dimethylcyclohexyl]-2-[(3R)-4-(4-methylphenyl)sulfonyl-2-oxo-1,3-dihydropyrazin-3-yl]acetamide |
|---|---|
| PubChem CID | 68941901 |
| Molecular Formula | C26H40N4O4S |
| Molecular Weight | 504.70 g/mol |
| Exact Mass | 504.28 |
| IUPAC Name | N-[(1R,4R)-4-(2,2-dimethylpropylamino)-2,2-dimethylcyclohexyl]-2-[(3R)-4-(4-methylphenyl)sulfonyl-2-oxo-1,3-dihydropyrazin-3-yl]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N2C=CNC(=O)[C@H]2CC(=O)N[C@@H]2CC[C@@H](NCC(C)(C)C)CC2(C)C)cc1 |
| InChI | InChI=1S/C26H40N4O4S/c1-18-7-10-20(11-8-18)35(33,34)30-14-13-27-24(32)21(30)15-23(31)29-22-12-9-19(16-26(22,5)6)28-17-25(2,3)4/h7-8,10-11,13-14,19,21-22,28H,9,12,15-17H2,1-6H3,(H,27,32)(H,29,31)/t19-,21-,22-/m1/s1 |
| InChIKey | CAJBPLNTTZFUER-CEMLEFRQSA-N |
| XLogP | 3.04 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.70 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |