C28H35ClF3N3O4S — CID 154143718
(3S)-3-[(4-chloro-2,5-dimethylphenyl)sulfonylamino]-4,4,4-trifluoro-N-[(1R)-6-[(3-hydroxypiperidin-1-yl)methyl]-1,2,3,4-tetrahydronaphthalen-1-yl]butanamide (PubChem CID 154143718) has the molecular formula C28H35ClF3N3O4S and a molecular weight of 602.12 g/mol. Its IUPAC name is (3S)-3-[(4-chloro-2,5-dimethylphenyl)sulfonylamino]-4,4,4-trifluoro-N-[(1R)-6-[(3-hydroxypiperidin-1-yl)methyl]-1,2,3,4-tetrahydronaphthalen-1-yl]butanamide.
| Compound Name | (3S)-3-[(4-chloro-2,5-dimethylphenyl)sulfonylamino]-4,4,4-trifluoro-N-[(1R)-6-[(3-hydroxypiperidin-1-yl)methyl]-1,2,3,4-tetrahydronaphthalen-1-yl]butanamide |
|---|---|
| PubChem CID | 154143718 |
| Molecular Formula | C28H35ClF3N3O4S |
| Molecular Weight | 602.12 g/mol |
| Exact Mass | 601.20 |
| IUPAC Name | (3S)-3-[(4-chloro-2,5-dimethylphenyl)sulfonylamino]-4,4,4-trifluoro-N-[(1R)-6-[(3-hydroxypiperidin-1-yl)methyl]-1,2,3,4-tetrahydronaphthalen-1-yl]butanamide |
| SMILES | Cc1cc(S(=O)(=O)N[C@@H](CC(=O)N[C@@H]2CCCc3cc(CN4CCCC(O)C4)ccc32)C(F)(F)F)c(C)cc1Cl |
| InChI | InChI=1S/C28H35ClF3N3O4S/c1-17-12-25(18(2)11-23(17)29)40(38,39)34-26(28(30,31)32)14-27(37)33-24-7-3-5-20-13-19(8-9-22(20)24)15-35-10-4-6-21(36)16-35/h8-9,11-13,21,24,26,34,36H,3-7,10,14-16H2,1-2H3,(H,33,37)/t21?,24-,26+/m1/s1 |
| InChIKey | SSELRHLFQUHRDN-KGLYDCNGSA-N |
| XLogP | 4.71 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.12 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |