C29H35F6N3O3S — CID 154211926
(3R)-N-[(1R)-6-[(3,3-dimethylpiperidin-1-yl)methyl]-1,2,3,4-tetrahydronaphthalen-1-yl]-4,4,4-trifluoro-3-[[3-(trifluoromethyl)phenyl]sulfonylamino]butanamide (PubChem CID 154211926) has the molecular formula C29H35F6N3O3S and a molecular weight of 619.67 g/mol. Its IUPAC name is (3R)-N-[(1R)-6-[(3,3-dimethylpiperidin-1-yl)methyl]-1,2,3,4-tetrahydronaphthalen-1-yl]-4,4,4-trifluoro-3-[[3-(trifluoromethyl)phenyl]sulfonylamino]butanamide.
| Compound Name | (3R)-N-[(1R)-6-[(3,3-dimethylpiperidin-1-yl)methyl]-1,2,3,4-tetrahydronaphthalen-1-yl]-4,4,4-trifluoro-3-[[3-(trifluoromethyl)phenyl]sulfonylamino]butanamide |
|---|---|
| PubChem CID | 154211926 |
| Molecular Formula | C29H35F6N3O3S |
| Molecular Weight | 619.67 g/mol |
| Exact Mass | 619.23 |
| IUPAC Name | (3R)-N-[(1R)-6-[(3,3-dimethylpiperidin-1-yl)methyl]-1,2,3,4-tetrahydronaphthalen-1-yl]-4,4,4-trifluoro-3-[[3-(trifluoromethyl)phenyl]sulfonylamino]butanamide |
| SMILES | CC1(C)CCCN(Cc2ccc3c(c2)CCC[C@H]3NC(=O)C[C@@H](NS(=O)(=O)c2cccc(C(F)(F)F)c2)C(F)(F)F)C1 |
| InChI | InChI=1S/C29H35F6N3O3S/c1-27(2)12-5-13-38(18-27)17-19-10-11-23-20(14-19)6-3-9-24(23)36-26(39)16-25(29(33,34)35)37-42(40,41)22-8-4-7-21(15-22)28(30,31)32/h4,7-8,10-11,14-15,24-25,37H,3,5-6,9,12-13,16-18H2,1-2H3,(H,36,39)/t24-,25-/m1/s1 |
| InChIKey | FNJMEGPBOQRNNX-JWQCQUIFSA-N |
| XLogP | 6.12 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.67 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |