C26H30F5N3O3S — CID 154260878
(3R)-3-[(3,5-difluorophenyl)sulfonylamino]-4,4,4-trifluoro-N-[(1R)-6-(piperidin-1-ylmethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]butanamide (PubChem CID 154260878) has the molecular formula C26H30F5N3O3S and a molecular weight of 559.60 g/mol. Its IUPAC name is (3R)-3-[(3,5-difluorophenyl)sulfonylamino]-4,4,4-trifluoro-N-[(1R)-6-(piperidin-1-ylmethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]butanamide.
| Compound Name | (3R)-3-[(3,5-difluorophenyl)sulfonylamino]-4,4,4-trifluoro-N-[(1R)-6-(piperidin-1-ylmethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]butanamide |
|---|---|
| PubChem CID | 154260878 |
| Molecular Formula | C26H30F5N3O3S |
| Molecular Weight | 559.60 g/mol |
| Exact Mass | 559.19 |
| IUPAC Name | (3R)-3-[(3,5-difluorophenyl)sulfonylamino]-4,4,4-trifluoro-N-[(1R)-6-(piperidin-1-ylmethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]butanamide |
| SMILES | O=C(C[C@@H](NS(=O)(=O)c1cc(F)cc(F)c1)C(F)(F)F)N[C@@H]1CCCc2cc(CN3CCCCC3)ccc21 |
| InChI | InChI=1S/C26H30F5N3O3S/c27-19-12-20(28)14-21(13-19)38(36,37)33-24(26(29,30)31)15-25(35)32-23-6-4-5-18-11-17(7-8-22(18)23)16-34-9-2-1-3-10-34/h7-8,11-14,23-24,33H,1-6,9-10,15-16H2,(H,32,35)/t23-,24-/m1/s1 |
| InChIKey | NIUCGTZZSFIGTI-DNQXCXABSA-N |
| XLogP | 4.74 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.60 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |