C32H33AsCl2F3N2O3S — CID 87738171
CID 87738171 (PubChem CID 87738171) has the molecular formula C32H33AsCl2F3N2O3S and a molecular weight of 728.52 g/mol.
| Compound Name | CID 87738171 |
|---|---|
| PubChem CID | 87738171 |
| Molecular Formula | C32H33AsCl2F3N2O3S |
| Molecular Weight | 728.52 g/mol |
| Exact Mass | 727.08 |
| IUPAC Name | — |
| SMILES | O=C(CC([As]S(=O)(=O)c1cccc(C(F)(F)F)c1)c1cc(Cl)cc(Cl)c1)NC1CCCc2cc(CN3CCCCC3)ccc21 |
| InChI | InChI=1S/C32H33AsCl2F3N2O3S/c34-25-15-23(16-26(35)18-25)29(33-44(42,43)27-8-5-7-24(17-27)32(36,37)38)19-31(41)39-30-9-4-6-22-14-21(10-11-28(22)30)20-40-12-2-1-3-13-40/h5,7-8,10-11,14-18,29-30H,1-4,6,9,12-13,19-20H2,(H,39,41) |
| InChIKey | OYRWOVFWSVQPTG-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.52 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|