C26H30Cl2F3N3O3S — CID 11556150
(3S)-3-[(2,3-dichlorophenyl)sulfonylamino]-4,4,4-trifluoro-N-[(1R)-6-(piperidin-1-ylmethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]butanamide (PubChem CID 11556150) has the molecular formula C26H30Cl2F3N3O3S and a molecular weight of 592.51 g/mol. Its IUPAC name is (3S)-3-[(2,3-dichlorophenyl)sulfonylamino]-4,4,4-trifluoro-N-[(1R)-6-(piperidin-1-ylmethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]butanamide.
| Compound Name | (3S)-3-[(2,3-dichlorophenyl)sulfonylamino]-4,4,4-trifluoro-N-[(1R)-6-(piperidin-1-ylmethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]butanamide |
|---|---|
| PubChem CID | 11556150 |
| Molecular Formula | C26H30Cl2F3N3O3S |
| Molecular Weight | 592.51 g/mol |
| Exact Mass | 591.13 |
| IUPAC Name | (3S)-3-[(2,3-dichlorophenyl)sulfonylamino]-4,4,4-trifluoro-N-[(1R)-6-(piperidin-1-ylmethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]butanamide |
| SMILES | O=C(C[C@H](NS(=O)(=O)c1cccc(Cl)c1Cl)C(F)(F)F)N[C@@H]1CCCc2cc(CN3CCCCC3)ccc21 |
| InChI | InChI=1S/C26H30Cl2F3N3O3S/c27-20-7-5-9-22(25(20)28)38(36,37)33-23(26(29,30)31)15-24(35)32-21-8-4-6-18-14-17(10-11-19(18)21)16-34-12-2-1-3-13-34/h5,7,9-11,14,21,23,33H,1-4,6,8,12-13,15-16H2,(H,32,35)/t21-,23+/m1/s1 |
| InChIKey | CGHGVJGOUYUXLB-GGAORHGYSA-N |
| XLogP | 5.77 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.51 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |