C29H37F3N4O4S — CID 11714109
(3R)-4,4,4-trifluoro-3-[(4-methyl-2,3-dihydro-1,4-benzoxazin-7-yl)sulfonylamino]-N-[(1R)-6-(piperidin-1-ylmethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]butanamide (PubChem CID 11714109) has the molecular formula C29H37F3N4O4S and a molecular weight of 594.70 g/mol. Its IUPAC name is (3R)-4,4,4-trifluoro-3-[(4-methyl-2,3-dihydro-1,4-benzoxazin-7-yl)sulfonylamino]-N-[(1R)-6-(piperidin-1-ylmethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]butanamide.
| Compound Name | (3R)-4,4,4-trifluoro-3-[(4-methyl-2,3-dihydro-1,4-benzoxazin-7-yl)sulfonylamino]-N-[(1R)-6-(piperidin-1-ylmethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]butanamide |
|---|---|
| PubChem CID | 11714109 |
| Molecular Formula | C29H37F3N4O4S |
| Molecular Weight | 594.70 g/mol |
| Exact Mass | 594.25 |
| IUPAC Name | (3R)-4,4,4-trifluoro-3-[(4-methyl-2,3-dihydro-1,4-benzoxazin-7-yl)sulfonylamino]-N-[(1R)-6-(piperidin-1-ylmethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]butanamide |
| SMILES | CN1CCOc2cc(S(=O)(=O)N[C@H](CC(=O)N[C@@H]3CCCc4cc(CN5CCCCC5)ccc43)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C29H37F3N4O4S/c1-35-14-15-40-26-17-22(9-11-25(26)35)41(38,39)34-27(29(30,31)32)18-28(37)33-24-7-5-6-21-16-20(8-10-23(21)24)19-36-12-3-2-4-13-36/h8-11,16-17,24,27,34H,2-7,12-15,18-19H2,1H3,(H,33,37)/t24-,27-/m1/s1 |
| InChIKey | HFPXTNSUDMFEPG-SHQCIBLASA-N |
| XLogP | 4.29 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.70 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |