C28H33F6N3O3S — CID 154292506
(3S)-4,4,4-trifluoro-N-[(1R)-6-[(4-methylpiperidin-1-yl)methyl]-1,2,3,4-tetrahydronaphthalen-1-yl]-3-[[3-(trifluoromethyl)phenyl]sulfonylamino]butanamide (PubChem CID 154292506) has the molecular formula C28H33F6N3O3S and a molecular weight of 605.65 g/mol. Its IUPAC name is (3S)-4,4,4-trifluoro-N-[(1R)-6-[(4-methylpiperidin-1-yl)methyl]-1,2,3,4-tetrahydronaphthalen-1-yl]-3-[[3-(trifluoromethyl)phenyl]sulfonylamino]butanamide.
| Compound Name | (3S)-4,4,4-trifluoro-N-[(1R)-6-[(4-methylpiperidin-1-yl)methyl]-1,2,3,4-tetrahydronaphthalen-1-yl]-3-[[3-(trifluoromethyl)phenyl]sulfonylamino]butanamide |
|---|---|
| PubChem CID | 154292506 |
| Molecular Formula | C28H33F6N3O3S |
| Molecular Weight | 605.65 g/mol |
| Exact Mass | 605.21 |
| IUPAC Name | (3S)-4,4,4-trifluoro-N-[(1R)-6-[(4-methylpiperidin-1-yl)methyl]-1,2,3,4-tetrahydronaphthalen-1-yl]-3-[[3-(trifluoromethyl)phenyl]sulfonylamino]butanamide |
| SMILES | CC1CCN(Cc2ccc3c(c2)CCC[C@H]3NC(=O)C[C@H](NS(=O)(=O)c2cccc(C(F)(F)F)c2)C(F)(F)F)CC1 |
| InChI | InChI=1S/C28H33F6N3O3S/c1-18-10-12-37(13-11-18)17-19-8-9-23-20(14-19)4-2-7-24(23)35-26(38)16-25(28(32,33)34)36-41(39,40)22-6-3-5-21(15-22)27(29,30)31/h3,5-6,8-9,14-15,18,24-25,36H,2,4,7,10-13,16-17H2,1H3,(H,35,38)/t24-,25+/m1/s1 |
| InChIKey | OVNPSIBLDIMBTL-RPBOFIJWSA-N |
| XLogP | 5.73 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.65 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |