C33H37N3O4 — CID 58842514
[4-[5-[(3-methoxyphenyl)methyl]-1,2,4-oxadiazol-3-yl]-4-phenylcyclohexyl] N-(4-phenylbutyl)carbamate (PubChem CID 58842514) has the molecular formula C33H37N3O4 and a molecular weight of 539.68 g/mol. Its IUPAC name is [4-[5-[(3-methoxyphenyl)methyl]-1,2,4-oxadiazol-3-yl]-4-phenylcyclohexyl] N-(4-phenylbutyl)carbamate.
| Compound Name | [4-[5-[(3-methoxyphenyl)methyl]-1,2,4-oxadiazol-3-yl]-4-phenylcyclohexyl] N-(4-phenylbutyl)carbamate |
|---|---|
| PubChem CID | 58842514 |
| Molecular Formula | C33H37N3O4 |
| Molecular Weight | 539.68 g/mol |
| Exact Mass | 539.28 |
| IUPAC Name | [4-[5-[(3-methoxyphenyl)methyl]-1,2,4-oxadiazol-3-yl]-4-phenylcyclohexyl] N-(4-phenylbutyl)carbamate |
| SMILES | COc1cccc(Cc2nc(C3(c4ccccc4)CCC(OC(=O)NCCCCc4ccccc4)CC3)no2)c1 |
| InChI | InChI=1S/C33H37N3O4/c1-38-29-17-10-14-26(23-29)24-30-35-31(36-40-30)33(27-15-6-3-7-16-27)20-18-28(19-21-33)39-32(37)34-22-9-8-13-25-11-4-2-5-12-25/h2-7,10-12,14-17,23,28H,8-9,13,18-22,24H2,1H3,(H,34,37) |
| InChIKey | JBWWMHVDEKKIAI-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 86.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.68 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|