C20H28N6O6S2 — CID 58843271
(2R)-1-[(2R)-3-[[(3R)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-3-yl]methyldisulfanyl]-2-[(4-oxoazetidine-2-carbonyl)amino]propanoyl]pyrrolidine-2-carboxamide (PubChem CID 58843271) has the molecular formula C20H28N6O6S2 and a molecular weight of 512.61 g/mol. Its IUPAC name is (2R)-1-[(2R)-3-[[(3R)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-3-yl]methyldisulfanyl]-2-[(4-oxoazetidine-2-carbonyl)amino]propanoyl]pyrrolidine-2-carboxamide.
| Compound Name | (2R)-1-[(2R)-3-[[(3R)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-3-yl]methyldisulfanyl]-2-[(4-oxoazetidine-2-carbonyl)amino]propanoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 58843271 |
| Molecular Formula | C20H28N6O6S2 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.15 |
| IUPAC Name | (2R)-1-[(2R)-3-[[(3R)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-3-yl]methyldisulfanyl]-2-[(4-oxoazetidine-2-carbonyl)amino]propanoyl]pyrrolidine-2-carboxamide |
| SMILES | NC(=O)[C@H]1CCCN1C(=O)[C@H](CSSC[C@@H]1NC(=O)C2CCCN2C1=O)NC(=O)C1CC(=O)N1 |
| InChI | InChI=1S/C20H28N6O6S2/c21-16(28)13-3-1-5-25(13)19(31)11(23-17(29)10-7-15(27)22-10)8-33-34-9-12-20(32)26-6-2-4-14(26)18(30)24-12/h10-14H,1-9H2,(H2,21,28)(H,22,27)(H,23,29)(H,24,30)/t10?,11-,12-,13+,14?/m0/s1 |
| InChIKey | JOGIBCDBPICVIU-VWGAPNJBSA-N |
| XLogP | -2.29 |
| TPSA | 171.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|