C18H31N5O4 — CID 70109005
N-[(2S)-6-amino-1-[(2S)-2-carbamoylpyrrolidin-1-yl]-1-oxohexan-2-yl]-3-methyl-6-oxopiperidine-2-carboxamide (PubChem CID 70109005) has the molecular formula C18H31N5O4 and a molecular weight of 381.48 g/mol. Its IUPAC name is N-[(2S)-6-amino-1-[(2S)-2-carbamoylpyrrolidin-1-yl]-1-oxohexan-2-yl]-3-methyl-6-oxopiperidine-2-carboxamide.
| Compound Name | N-[(2S)-6-amino-1-[(2S)-2-carbamoylpyrrolidin-1-yl]-1-oxohexan-2-yl]-3-methyl-6-oxopiperidine-2-carboxamide |
|---|---|
| PubChem CID | 70109005 |
| Molecular Formula | C18H31N5O4 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.24 |
| IUPAC Name | N-[(2S)-6-amino-1-[(2S)-2-carbamoylpyrrolidin-1-yl]-1-oxohexan-2-yl]-3-methyl-6-oxopiperidine-2-carboxamide |
| SMILES | CC1CCC(=O)NC1C(=O)N[C@@H](CCCCN)C(=O)N1CCC[C@H]1C(N)=O |
| InChI | InChI=1S/C18H31N5O4/c1-11-7-8-14(24)22-15(11)17(26)21-12(5-2-3-9-19)18(27)23-10-4-6-13(23)16(20)25/h11-13,15H,2-10,19H2,1H3,(H2,20,25)(H,21,26)(H,22,24)/t11?,12-,13-,15?/m0/s1 |
| InChIKey | SJXQJISDLQZUJY-FMPXUHTOSA-N |
| XLogP | -1.01 |
| TPSA | 147.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|