C18H31N7O4 — CID 22846155
(2S)-N-[(2S)-1-[(2S)-2-carbamoylpyrrolidin-1-yl]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-3,3-dimethyl-5-oxopyrrolidine-2-carboxamide (PubChem CID 22846155) has the molecular formula C18H31N7O4 and a molecular weight of 409.49 g/mol. Its IUPAC name is (2S)-N-[(2S)-1-[(2S)-2-carbamoylpyrrolidin-1-yl]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-3,3-dimethyl-5-oxopyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[(2S)-1-[(2S)-2-carbamoylpyrrolidin-1-yl]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-3,3-dimethyl-5-oxopyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 22846155 |
| Molecular Formula | C18H31N7O4 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | (2S)-N-[(2S)-1-[(2S)-2-carbamoylpyrrolidin-1-yl]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-3,3-dimethyl-5-oxopyrrolidine-2-carboxamide |
| SMILES | CC1(C)CC(=O)N[C@@H]1C(=O)N[C@@H](CCCN=C(N)N)C(=O)N1CCC[C@H]1C(N)=O |
| InChI | InChI=1S/C18H31N7O4/c1-18(2)9-12(26)24-13(18)15(28)23-10(5-3-7-22-17(20)21)16(29)25-8-4-6-11(25)14(19)27/h10-11,13H,3-9H2,1-2H3,(H2,19,27)(H,23,28)(H,24,26)(H4,20,21,22)/t10-,11-,13+/m0/s1 |
| InChIKey | NMHVBVGPKBTIKJ-GMXVVIOVSA-N |
| XLogP | -2.08 |
| TPSA | 186.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|