C20H34N6O6 — CID 173312527
(3S)-3-[[(2S)-1-[(2S)-2-acetamido-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carbonyl]amino]-5-methyl-4-oxohexanoic acid (PubChem CID 173312527) has the molecular formula C20H34N6O6 and a molecular weight of 454.53 g/mol. Its IUPAC name is (3S)-3-[[(2S)-1-[(2S)-2-acetamido-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carbonyl]amino]-5-methyl-4-oxohexanoic acid.
| Compound Name | (3S)-3-[[(2S)-1-[(2S)-2-acetamido-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carbonyl]amino]-5-methyl-4-oxohexanoic acid |
|---|---|
| PubChem CID | 173312527 |
| Molecular Formula | C20H34N6O6 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | (3S)-3-[[(2S)-1-[(2S)-2-acetamido-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carbonyl]amino]-5-methyl-4-oxohexanoic acid |
| SMILES | CC(=O)N[C@@H](CCCN=C(N)N)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CC(=O)O)C(=O)C(C)C |
| InChI | InChI=1S/C20H34N6O6/c1-11(2)17(30)14(10-16(28)29)25-18(31)15-7-5-9-26(15)19(32)13(24-12(3)27)6-4-8-23-20(21)22/h11,13-15H,4-10H2,1-3H3,(H,24,27)(H,25,31)(H,28,29)(H4,21,22,23)/t13-,14-,15-/m0/s1 |
| InChIKey | UCODYCWAFIRYCB-KKUMJFAQSA-N |
| XLogP | -1.28 |
| TPSA | 197.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|