C19H33NO3Si2 — CID 58844395
tert-butyl N-trimethylsilyl-N-[4-(1-trimethylsilyloxyethenyl)phenyl]carbamate (PubChem CID 58844395) has the molecular formula C19H33NO3Si2 and a molecular weight of 379.65 g/mol. Its IUPAC name is tert-butyl N-trimethylsilyl-N-[4-(1-trimethylsilyloxyethenyl)phenyl]carbamate.
| Compound Name | tert-butyl N-trimethylsilyl-N-[4-(1-trimethylsilyloxyethenyl)phenyl]carbamate |
|---|---|
| PubChem CID | 58844395 |
| Molecular Formula | C19H33NO3Si2 |
| Molecular Weight | 379.65 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | tert-butyl N-trimethylsilyl-N-[4-(1-trimethylsilyloxyethenyl)phenyl]carbamate |
| SMILES | C=C(O[Si](C)(C)C)c1ccc(N(C(=O)OC(C)(C)C)[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C19H33NO3Si2/c1-15(23-25(8,9)10)16-11-13-17(14-12-16)20(24(5,6)7)18(21)22-19(2,3)4/h11-14H,1H2,2-10H3 |
| InChIKey | BNUYZQRXZBFRHV-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.65 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|