C17H32N2O2Si2 — CID 91696900
tert-butyl N-trimethylsilyl-N-[2-(trimethylsilylamino)phenyl]carbamate (PubChem CID 91696900) has the molecular formula C17H32N2O2Si2 and a molecular weight of 352.63 g/mol. Its IUPAC name is tert-butyl N-trimethylsilyl-N-[2-(trimethylsilylamino)phenyl]carbamate.
| Compound Name | tert-butyl N-trimethylsilyl-N-[2-(trimethylsilylamino)phenyl]carbamate |
|---|---|
| PubChem CID | 91696900 |
| Molecular Formula | C17H32N2O2Si2 |
| Molecular Weight | 352.63 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | tert-butyl N-trimethylsilyl-N-[2-(trimethylsilylamino)phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(c1ccccc1N[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C17H32N2O2Si2/c1-17(2,3)21-16(20)19(23(7,8)9)15-13-11-10-12-14(15)18-22(4,5)6/h10-13,18H,1-9H3 |
| InChIKey | UCVPYQOHHCFCPQ-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.63 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|