C18H21N3O6S2 — CID 58845142
N-hydroxy-4-[4-(2-methylsulfonylphenyl)sulfonylpiperazin-1-yl]benzamide (PubChem CID 58845142) has the molecular formula C18H21N3O6S2 and a molecular weight of 439.52 g/mol. Its IUPAC name is N-hydroxy-4-[4-(2-methylsulfonylphenyl)sulfonylpiperazin-1-yl]benzamide.
| Compound Name | N-hydroxy-4-[4-(2-methylsulfonylphenyl)sulfonylpiperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 58845142 |
| Molecular Formula | C18H21N3O6S2 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | N-hydroxy-4-[4-(2-methylsulfonylphenyl)sulfonylpiperazin-1-yl]benzamide |
| SMILES | CS(=O)(=O)c1ccccc1S(=O)(=O)N1CCN(c2ccc(C(=O)NO)cc2)CC1 |
| InChI | InChI=1S/C18H21N3O6S2/c1-28(24,25)16-4-2-3-5-17(16)29(26,27)21-12-10-20(11-13-21)15-8-6-14(7-9-15)18(22)19-23/h2-9,23H,10-13H2,1H3,(H,19,22) |
| InChIKey | VVIDXBWXKNVSNF-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 124.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|