C19H14FN5O2 — CID 58847564
3-[2-fluoro-6-methyl-3-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)methyl]phenoxy]-5-isocyanobenzonitrile (PubChem CID 58847564) has the molecular formula C19H14FN5O2 and a molecular weight of 363.35 g/mol. Its IUPAC name is 3-[2-fluoro-6-methyl-3-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)methyl]phenoxy]-5-isocyanobenzonitrile.
| Compound Name | 3-[2-fluoro-6-methyl-3-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)methyl]phenoxy]-5-isocyanobenzonitrile |
|---|---|
| PubChem CID | 58847564 |
| Molecular Formula | C19H14FN5O2 |
| Molecular Weight | 363.35 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 3-[2-fluoro-6-methyl-3-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)methyl]phenoxy]-5-isocyanobenzonitrile |
| SMILES | [C-]#[N+]c1cc(C#N)cc(Oc2c(C)ccc(Cc3n[nH]c(=O)n3C)c2F)c1 |
| InChI | InChI=1S/C19H14FN5O2/c1-11-4-5-13(8-16-23-24-19(26)25(16)3)17(20)18(11)27-15-7-12(10-21)6-14(9-15)22-2/h4-7,9H,8H2,1,3H3,(H,24,26) |
| InChIKey | DXUVLMJOGQNVSD-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 88.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.35 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|