C19H13ClFN3O2 — CID 18440033
3-[6-chloro-2-fluoro-3-[(6-oxo-1H-pyridazin-3-yl)methyl]phenoxy]-5-methylbenzonitrile (PubChem CID 18440033) has the molecular formula C19H13ClFN3O2 and a molecular weight of 369.78 g/mol. Its IUPAC name is 3-[6-chloro-2-fluoro-3-[(6-oxo-1H-pyridazin-3-yl)methyl]phenoxy]-5-methylbenzonitrile.
| Compound Name | 3-[6-chloro-2-fluoro-3-[(6-oxo-1H-pyridazin-3-yl)methyl]phenoxy]-5-methylbenzonitrile |
|---|---|
| PubChem CID | 18440033 |
| Molecular Formula | C19H13ClFN3O2 |
| Molecular Weight | 369.78 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | 3-[6-chloro-2-fluoro-3-[(6-oxo-1H-pyridazin-3-yl)methyl]phenoxy]-5-methylbenzonitrile |
| SMILES | Cc1cc(C#N)cc(Oc2c(Cl)ccc(Cc3ccc(=O)[nH]n3)c2F)c1 |
| InChI | InChI=1S/C19H13ClFN3O2/c1-11-6-12(10-22)8-15(7-11)26-19-16(20)4-2-13(18(19)21)9-14-3-5-17(25)24-23-14/h2-8H,9H2,1H3,(H,24,25) |
| InChIKey | YNBYIXYWGDSYCN-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 78.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.78 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |