C18H12ClFN2O3 — CID 66999191
ethyl 2-[4-chloro-3-(3,5-dicyanophenoxy)-2-fluorophenyl]acetate (PubChem CID 66999191) has the molecular formula C18H12ClFN2O3 and a molecular weight of 358.76 g/mol. Its IUPAC name is ethyl 2-[4-chloro-3-(3,5-dicyanophenoxy)-2-fluorophenyl]acetate.
| Compound Name | ethyl 2-[4-chloro-3-(3,5-dicyanophenoxy)-2-fluorophenyl]acetate |
|---|---|
| PubChem CID | 66999191 |
| Molecular Formula | C18H12ClFN2O3 |
| Molecular Weight | 358.76 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | ethyl 2-[4-chloro-3-(3,5-dicyanophenoxy)-2-fluorophenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(Cl)c(Oc2cc(C#N)cc(C#N)c2)c1F |
| InChI | InChI=1S/C18H12ClFN2O3/c1-2-24-16(23)8-13-3-4-15(19)18(17(13)20)25-14-6-11(9-21)5-12(7-14)10-22/h3-7H,2,8H2,1H3 |
| InChIKey | XXUQKSHPPYBDFB-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 83.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.76 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |