C18H15ClFNO3 — CID 66999330
ethyl 2-[3-(3-chloro-5-cyanophenoxy)-2-fluoro-4-methylphenyl]acetate (PubChem CID 66999330) has the molecular formula C18H15ClFNO3 and a molecular weight of 347.77 g/mol. Its IUPAC name is ethyl 2-[3-(3-chloro-5-cyanophenoxy)-2-fluoro-4-methylphenyl]acetate.
| Compound Name | ethyl 2-[3-(3-chloro-5-cyanophenoxy)-2-fluoro-4-methylphenyl]acetate |
|---|---|
| PubChem CID | 66999330 |
| Molecular Formula | C18H15ClFNO3 |
| Molecular Weight | 347.77 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | ethyl 2-[3-(3-chloro-5-cyanophenoxy)-2-fluoro-4-methylphenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(C)c(Oc2cc(Cl)cc(C#N)c2)c1F |
| InChI | InChI=1S/C18H15ClFNO3/c1-3-23-16(22)8-13-5-4-11(2)18(17(13)20)24-15-7-12(10-21)6-14(19)9-15/h4-7,9H,3,8H2,1-2H3 |
| InChIKey | QHZSEKAGDBDLNF-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.77 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |