C16H11Cl2NO2 — CID 21079734
2-[3-(3-chloro-5-cyanophenoxy)-4-methylphenyl]acetyl chloride (PubChem CID 21079734) has the molecular formula C16H11Cl2NO2 and a molecular weight of 320.18 g/mol. Its IUPAC name is 2-[3-(3-chloro-5-cyanophenoxy)-4-methylphenyl]acetyl chloride.
| Compound Name | 2-[3-(3-chloro-5-cyanophenoxy)-4-methylphenyl]acetyl chloride |
|---|---|
| PubChem CID | 21079734 |
| Molecular Formula | C16H11Cl2NO2 |
| Molecular Weight | 320.18 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | 2-[3-(3-chloro-5-cyanophenoxy)-4-methylphenyl]acetyl chloride |
| SMILES | Cc1ccc(CC(=O)Cl)cc1Oc1cc(Cl)cc(C#N)c1 |
| InChI | InChI=1S/C16H11Cl2NO2/c1-10-2-3-11(7-16(18)20)6-15(10)21-14-5-12(9-19)4-13(17)8-14/h2-6,8H,7H2,1H3 |
| InChIKey | CPOAVGAMVWHMBC-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.18 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|