C14H8Cl2FNO — CID 59451640
3-chloro-5-(6-chloro-2-fluoro-3-methylphenoxy)benzonitrile (PubChem CID 59451640) has the molecular formula C14H8Cl2FNO and a molecular weight of 296.13 g/mol. Its IUPAC name is 3-chloro-5-(6-chloro-2-fluoro-3-methylphenoxy)benzonitrile.
| Compound Name | 3-chloro-5-(6-chloro-2-fluoro-3-methylphenoxy)benzonitrile |
|---|---|
| PubChem CID | 59451640 |
| Molecular Formula | C14H8Cl2FNO |
| Molecular Weight | 296.13 g/mol |
| Exact Mass | 295.00 |
| IUPAC Name | 3-chloro-5-(6-chloro-2-fluoro-3-methylphenoxy)benzonitrile |
| SMILES | Cc1ccc(Cl)c(Oc2cc(Cl)cc(C#N)c2)c1F |
| InChI | InChI=1S/C14H8Cl2FNO/c1-8-2-3-12(16)14(13(8)17)19-11-5-9(7-18)4-10(15)6-11/h2-6H,1H3 |
| InChIKey | ZSWXSINGKZZWMW-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.13 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |