C14H7Br2ClFNO — CID 69045756
3-[3-bromo-6-(bromomethyl)-2-fluorophenoxy]-5-chlorobenzonitrile (PubChem CID 69045756) has the molecular formula C14H7Br2ClFNO and a molecular weight of 419.48 g/mol. Its IUPAC name is 3-[3-bromo-6-(bromomethyl)-2-fluorophenoxy]-5-chlorobenzonitrile.
| Compound Name | 3-[3-bromo-6-(bromomethyl)-2-fluorophenoxy]-5-chlorobenzonitrile |
|---|---|
| PubChem CID | 69045756 |
| Molecular Formula | C14H7Br2ClFNO |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 416.86 |
| IUPAC Name | 3-[3-bromo-6-(bromomethyl)-2-fluorophenoxy]-5-chlorobenzonitrile |
| SMILES | N#Cc1cc(Cl)cc(Oc2c(CBr)ccc(Br)c2F)c1 |
| InChI | InChI=1S/C14H7Br2ClFNO/c15-6-9-1-2-12(16)13(18)14(9)20-11-4-8(7-19)3-10(17)5-11/h1-5H,6H2 |
| InChIKey | JRWRDENFENBYSG-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|