C14H6BrClFNO2 — CID 86078195
3-(3-bromo-2-fluoro-6-formylphenoxy)-5-chlorobenzonitrile (PubChem CID 86078195) has the molecular formula C14H6BrClFNO2 and a molecular weight of 354.56 g/mol. Its IUPAC name is 3-(3-bromo-2-fluoro-6-formylphenoxy)-5-chlorobenzonitrile.
| Compound Name | 3-(3-bromo-2-fluoro-6-formylphenoxy)-5-chlorobenzonitrile |
|---|---|
| PubChem CID | 86078195 |
| Molecular Formula | C14H6BrClFNO2 |
| Molecular Weight | 354.56 g/mol |
| Exact Mass | 352.93 |
| IUPAC Name | 3-(3-bromo-2-fluoro-6-formylphenoxy)-5-chlorobenzonitrile |
| SMILES | N#Cc1cc(Cl)cc(Oc2c(C=O)ccc(Br)c2F)c1 |
| InChI | InChI=1S/C14H6BrClFNO2/c15-12-2-1-9(7-19)14(13(12)17)20-11-4-8(6-18)3-10(16)5-11/h1-5,7H |
| InChIKey | ZBHRNLMFKLPKRA-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.56 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|