C20H18ClFN2O4Os — CID 160697878
tert-butyl N-[[3-(3-chloro-5-cyanophenoxy)-2-fluoro-4-formylphenyl]methyl]carbamate;osmium (PubChem CID 160697878) has the molecular formula C20H18ClFN2O4Os and a molecular weight of 595.06 g/mol. Its IUPAC name is tert-butyl N-[[3-(3-chloro-5-cyanophenoxy)-2-fluoro-4-formylphenyl]methyl]carbamate;osmium.
| Compound Name | tert-butyl N-[[3-(3-chloro-5-cyanophenoxy)-2-fluoro-4-formylphenyl]methyl]carbamate;osmium |
|---|---|
| PubChem CID | 160697878 |
| Molecular Formula | C20H18ClFN2O4Os |
| Molecular Weight | 595.06 g/mol |
| Exact Mass | 596.06 |
| IUPAC Name | tert-butyl N-[[3-(3-chloro-5-cyanophenoxy)-2-fluoro-4-formylphenyl]methyl]carbamate;osmium |
| SMILES | CC(C)(C)OC(=O)NCc1ccc(C=O)c(Oc2cc(Cl)cc(C#N)c2)c1F.[Os] |
| InChI | InChI=1S/C20H18ClFN2O4.Os/c1-20(2,3)28-19(26)24-10-13-4-5-14(11-25)18(17(13)22)27-16-7-12(9-23)6-15(21)8-16;/h4-8,11H,10H2,1-3H3,(H,24,26); |
| InChIKey | RQFOZQYGXCOWFE-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.06 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|