C19H17BrClNO3 — CID 143122010
ethyl 3-[4-bromo-3-(3-chloro-5-cyanophenoxy)-2-methylphenyl]propanoate (PubChem CID 143122010) has the molecular formula C19H17BrClNO3 and a molecular weight of 422.71 g/mol. Its IUPAC name is ethyl 3-[4-bromo-3-(3-chloro-5-cyanophenoxy)-2-methylphenyl]propanoate.
| Compound Name | ethyl 3-[4-bromo-3-(3-chloro-5-cyanophenoxy)-2-methylphenyl]propanoate |
|---|---|
| PubChem CID | 143122010 |
| Molecular Formula | C19H17BrClNO3 |
| Molecular Weight | 422.71 g/mol |
| Exact Mass | 421.01 |
| IUPAC Name | ethyl 3-[4-bromo-3-(3-chloro-5-cyanophenoxy)-2-methylphenyl]propanoate |
| SMILES | CCOC(=O)CCc1ccc(Br)c(Oc2cc(Cl)cc(C#N)c2)c1C |
| InChI | InChI=1S/C19H17BrClNO3/c1-3-24-18(23)7-5-14-4-6-17(20)19(12(14)2)25-16-9-13(11-22)8-15(21)10-16/h4,6,8-10H,3,5,7H2,1-2H3 |
| InChIKey | URBQFAIKPZXRGU-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.71 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |