C46H30Cl2F2N8O8 — CID 87872812
bis[[3-[[4-chloro-3-(3,5-dicyanophenoxy)-2-fluorophenyl]methyl]-5-methyl-6-oxopyridazin-1-yl]methyl] butanedioate (PubChem CID 87872812) has the molecular formula C46H30Cl2F2N8O8 and a molecular weight of 931.70 g/mol. Its IUPAC name is bis[[3-[[4-chloro-3-(3,5-dicyanophenoxy)-2-fluorophenyl]methyl]-5-methyl-6-oxopyridazin-1-yl]methyl] butanedioate.
| Compound Name | bis[[3-[[4-chloro-3-(3,5-dicyanophenoxy)-2-fluorophenyl]methyl]-5-methyl-6-oxopyridazin-1-yl]methyl] butanedioate |
|---|---|
| PubChem CID | 87872812 |
| Molecular Formula | C46H30Cl2F2N8O8 |
| Molecular Weight | 931.70 g/mol |
| Exact Mass | 930.15 |
| IUPAC Name | bis[[3-[[4-chloro-3-(3,5-dicyanophenoxy)-2-fluorophenyl]methyl]-5-methyl-6-oxopyridazin-1-yl]methyl] butanedioate |
| SMILES | Cc1cc(Cc2ccc(Cl)c(Oc3cc(C#N)cc(C#N)c3)c2F)nn(COC(=O)CCC(=O)OCn2nc(Cc3ccc(Cl)c(Oc4cc(C#N)cc(C#N)c4)c3F)cc(C)c2=O)c1=O |
| InChI | InChI=1S/C46H30Cl2F2N8O8/c1-25-9-33(17-31-3-5-37(47)43(41(31)49)65-35-13-27(19-51)11-28(14-35)20-52)55-57(45(25)61)23-63-39(59)7-8-40(60)64-24-58-46(62)26(2)10-34(56-58)18-32-4-6-38(48)44(42(32)50)66-36-15-29(21-53)12-30(16-36)22-54/h3-6,9-16H,7-8,17-18,23-24H2,1-2H3 |
| InChIKey | JSEOACDFJYSBFK-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 236.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 931.70 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |