C21H15ClFN4Na2O6P — CID 69410455
CID 69410455 (PubChem CID 69410455) has the molecular formula C21H15ClFN4Na2O6P and a molecular weight of 550.78 g/mol.
| Compound Name | CID 69410455 |
|---|---|
| PubChem CID | 69410455 |
| Molecular Formula | C21H15ClFN4Na2O6P |
| Molecular Weight | 550.78 g/mol |
| Exact Mass | 550.02 |
| IUPAC Name | — |
| SMILES | Cc1cc(Cc2ccc(Cl)c(Oc3cc(C#N)cc(C#N)c3)c2F)nn(COP(=O)(O)O)c1=O.[Na].[Na] |
| InChI | InChI=1S/C21H15ClFN4O6P.2Na/c1-12-4-16(26-27(21(12)28)11-32-34(29,30)31)8-15-2-3-18(22)20(19(15)23)33-17-6-13(9-24)5-14(7-17)10-25;;/h2-7H,8,11H2,1H3,(H2,29,30,31);; |
| InChIKey | ROGVURGDYQQYAW-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 158.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.78 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|