About tert-butyl 4-(iminomethyl)piperazine-1-carboxylate;tungsten
tert-butyl 4-(iminomethyl)piperazine-1-carboxylate;tungsten (PubChem CID 58852050) has the molecular formula C10H18N3O2W-
and a molecular weight of 396.11 g/mol. Its IUPAC name is tert-butyl 4-(iminomethyl)piperazine-1-carboxylate;tungsten.
Molecular Properties
| Compound Name | tert-butyl 4-(iminomethyl)piperazine-1-carboxylate;tungsten |
| PubChem CID | 58852050 |
| Molecular Formula | C10H18N3O2W- |
| Molecular Weight | 396.11 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | tert-butyl 4-(iminomethyl)piperazine-1-carboxylate;tungsten |
| SMILES | [H]/N=[C-]/N1CCN(C(=O)OC(C)(C)C)CC1.[W] |
| InChI | InChI=1S/C10H18N3O2.W/c1-10(2,3)15-9(14)13-6-4-12(8-11)5-7-13;/h11H,4-7H2,1-3H3;/q-1; |
| InChIKey | DNPVGQVIQXLCTK-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 56.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.11 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 4-(iminomethyl)piperazine-1-carboxylate;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-(iminomethyl)piperazine-1-carboxylate;tungsten?
The IUPAC name of tert-butyl 4-(iminomethyl)piperazine-1-carboxylate;tungsten (CID 58852050) is tert-butyl 4-(iminomethyl)piperazine-1-carboxylate;tungsten.
What is the SMILES notation for tert-butyl 4-(iminomethyl)piperazine-1-carboxylate;tungsten?
The canonical SMILES for tert-butyl 4-(iminomethyl)piperazine-1-carboxylate;tungsten is [H]/N=[C-]/N1CCN(C(=O)OC(C)(C)C)CC1.[W].
What is the InChIKey of tert-butyl 4-(iminomethyl)piperazine-1-carboxylate;tungsten?
The InChIKey is DNPVGQVIQXLCTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N3O2.W/c1-10(2,3)15-9(14)13-6-4-12(8-11)5-7-13;/h11H,4-7H2,1-3H3;/q-1;.
What are the key properties of tert-butyl 4-(iminomethyl)piperazine-1-carboxylate;tungsten?
tert-butyl 4-(iminomethyl)piperazine-1-carboxylate;tungsten has a molecular weight of 396.11 g/mol, XLogP of 1.02, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-(iminomethyl)piperazine-1-carboxylate;tungsten is sourced from PubChem (CID 58852050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).