C19H17BrN2O3 — CID 58854118
ethyl 5-[2-(5-bromo-2-hydroxyphenyl)-5-methylpyrrol-1-yl]pyridine-3-carboxylate (PubChem CID 58854118) has the molecular formula C19H17BrN2O3 and a molecular weight of 401.26 g/mol. Its IUPAC name is ethyl 5-[2-(5-bromo-2-hydroxyphenyl)-5-methylpyrrol-1-yl]pyridine-3-carboxylate.
| Compound Name | ethyl 5-[2-(5-bromo-2-hydroxyphenyl)-5-methylpyrrol-1-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 58854118 |
| Molecular Formula | C19H17BrN2O3 |
| Molecular Weight | 401.26 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | ethyl 5-[2-(5-bromo-2-hydroxyphenyl)-5-methylpyrrol-1-yl]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cncc(-n2c(C)ccc2-c2cc(Br)ccc2O)c1 |
| InChI | InChI=1S/C19H17BrN2O3/c1-3-25-19(24)13-8-15(11-21-10-13)22-12(2)4-6-17(22)16-9-14(20)5-7-18(16)23/h4-11,23H,3H2,1-2H3 |
| InChIKey | JOZGORVPTWLJBZ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.26 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |