C20H19NO6S — CID 58856192
methyl (2R)-2-(1,3-dioxoinden-2-yl)-3-[4-(methanesulfonamido)phenyl]propanoate (PubChem CID 58856192) has the molecular formula C20H19NO6S and a molecular weight of 401.44 g/mol. Its IUPAC name is methyl (2R)-2-(1,3-dioxoinden-2-yl)-3-[4-(methanesulfonamido)phenyl]propanoate.
| Compound Name | methyl (2R)-2-(1,3-dioxoinden-2-yl)-3-[4-(methanesulfonamido)phenyl]propanoate |
|---|---|
| PubChem CID | 58856192 |
| Molecular Formula | C20H19NO6S |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | methyl (2R)-2-(1,3-dioxoinden-2-yl)-3-[4-(methanesulfonamido)phenyl]propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(NS(C)(=O)=O)cc1)C1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C20H19NO6S/c1-27-20(24)16(11-12-7-9-13(10-8-12)21-28(2,25)26)17-18(22)14-5-3-4-6-15(14)19(17)23/h3-10,16-17,21H,11H2,1-2H3/t16-/m1/s1 |
| InChIKey | JMHRGMIYSUDWDN-MRXNPFEDSA-N |
| XLogP | 2.09 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|