C12H9F3N3O2Y- — CID 58858647
3-(3-amino-4-methylbenzene-6-id-1-yl)-6-(trifluoromethyl)-1H-pyrimidine-2,4-dione;yttrium (PubChem CID 58858647) has the molecular formula C12H9F3N3O2Y- and a molecular weight of 373.12 g/mol. Its IUPAC name is 3-(3-amino-4-methylbenzene-6-id-1-yl)-6-(trifluoromethyl)-1H-pyrimidine-2,4-dione;yttrium.
| Compound Name | 3-(3-amino-4-methylbenzene-6-id-1-yl)-6-(trifluoromethyl)-1H-pyrimidine-2,4-dione;yttrium |
|---|---|
| PubChem CID | 58858647 |
| Molecular Formula | C12H9F3N3O2Y- |
| Molecular Weight | 373.12 g/mol |
| Exact Mass | 372.97 |
| IUPAC Name | 3-(3-amino-4-methylbenzene-6-id-1-yl)-6-(trifluoromethyl)-1H-pyrimidine-2,4-dione;yttrium |
| SMILES | Cc1c[c-]c(-n2c(=O)cc(C(F)(F)F)[nH]c2=O)cc1N.[Y] |
| InChI | InChI=1S/C12H9F3N3O2.Y/c1-6-2-3-7(4-8(6)16)18-10(19)5-9(12(13,14)15)17-11(18)20;/h2,4-5H,16H2,1H3,(H,17,20);/q-1; |
| InChIKey | PGXVARAULVLBOR-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 80.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.12 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|